C21H40N10O8 — CID 22650591
4-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-5-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid (PubChem CID 22650591) has the molecular formula C21H40N10O8 and a molecular weight of 560.61 g/mol. Its IUPAC name is 4-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-5-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-5-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 22650591 |
| Molecular Formula | C21H40N10O8 |
| Molecular Weight | 560.61 g/mol |
| Exact Mass | 560.30 |
| IUPAC Name | 4-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-5-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid |
| SMILES | CC(O)C(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CCC(=O)O)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C21H40N10O8/c1-10(32)15(31-16(35)11(22)4-2-8-27-20(23)24)18(37)29-12(6-7-14(33)34)17(36)30-13(19(38)39)5-3-9-28-21(25)26/h10-13,15,32H,2-9,22H2,1H3,(H,29,37)(H,30,36)(H,31,35)(H,33,34)(H,38,39)(H4,23,24,27)(H4,25,26,28) |
| InChIKey | VKPUDORUIFREMW-UHFFFAOYSA-N |
| XLogP | -4.79 |
| TPSA | 336.95 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.61 |
| LogP ≤ 5 | -4.79 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|