C21H39N7O8 — CID 18300757
2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid (PubChem CID 18300757) has the molecular formula C21H39N7O8 and a molecular weight of 517.58 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18300757 |
| Molecular Formula | C21H39N7O8 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.29 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid |
| SMILES | CC(C)CC(N)C(=O)NC(C(=O)NC(CCCN=C(N)N)C(=O)NC(CCC(=O)O)C(=O)O)C(C)O |
| InChI | InChI=1S/C21H39N7O8/c1-10(2)9-12(22)17(32)28-16(11(3)29)19(34)26-13(5-4-8-25-21(23)24)18(33)27-14(20(35)36)6-7-15(30)31/h10-14,16,29H,4-9,22H2,1-3H3,(H,26,34)(H,27,33)(H,28,32)(H,30,31)(H,35,36)(H4,23,24,25) |
| InChIKey | SUIUNZRULLRIIC-UHFFFAOYSA-N |
| XLogP | -2.80 |
| TPSA | 272.55 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|