C22H44N10O6 — CID 22702881
2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 22702881) has the molecular formula C22H44N10O6 and a molecular weight of 544.66 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 22702881 |
| Molecular Formula | C22H44N10O6 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.34 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(C)CC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C22H44N10O6/c1-11(2)10-13(23)17(34)30-14(6-4-8-28-21(24)25)18(35)31-15(7-5-9-29-22(26)27)19(36)32-16(12(3)33)20(37)38/h11-16,33H,4-10,23H2,1-3H3,(H,30,34)(H,31,35)(H,32,36)(H,37,38)(H4,24,25,28)(H4,26,27,29) |
| InChIKey | WWKCTDWFJWIBNI-UHFFFAOYSA-N |
| XLogP | -3.61 |
| TPSA | 299.65 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | -3.61 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|