C22H44N8O6 — CID 18306303
2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 18306303) has the molecular formula C22H44N8O6 and a molecular weight of 516.64 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 18306303 |
| Molecular Formula | C22H44N8O6 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.34 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(C)CC(NC(=O)C(N)CCCCN)C(=O)NC(CCCN=C(N)N)C(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C22H44N8O6/c1-12(2)11-16(29-18(32)14(24)7-4-5-9-23)20(34)28-15(8-6-10-27-22(25)26)19(33)30-17(13(3)31)21(35)36/h12-17,31H,4-11,23-24H2,1-3H3,(H,28,34)(H,29,32)(H,30,33)(H,35,36)(H4,25,26,27) |
| InChIKey | GWSUNRPVAVNEKD-UHFFFAOYSA-N |
| XLogP | -2.54 |
| TPSA | 261.27 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|