C20H39N9O7 — CID 18303141
2-[[2-[[4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 18303141) has the molecular formula C20H39N9O7 and a molecular weight of 517.59 g/mol. Its IUPAC name is 2-[[2-[[4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[[4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 18303141 |
| Molecular Formula | C20H39N9O7 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.30 |
| IUPAC Name | 2-[[2-[[4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(CC(N)=O)NC(=O)C(N)CCCCN)C(=O)O |
| InChI | InChI=1S/C20H39N9O7/c1-10(30)15(19(35)36)29-17(33)12(6-4-8-26-20(24)25)27-18(34)13(9-14(23)31)28-16(32)11(22)5-2-3-7-21/h10-13,15,30H,2-9,21-22H2,1H3,(H2,23,31)(H,27,34)(H,28,32)(H,29,33)(H,35,36)(H4,24,25,26) |
| InChIKey | CAJSXEOVBKMLEY-UHFFFAOYSA-N |
| XLogP | -4.71 |
| TPSA | 304.36 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | -4.71 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|