C19H38N10O6 — CID 18233012
2-[[2-[[2-(2-aminopropanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 18233012) has the molecular formula C19H38N10O6 and a molecular weight of 502.58 g/mol. Its IUPAC name is 2-[[2-[[2-(2-aminopropanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[[2-(2-aminopropanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 18233012 |
| Molecular Formula | C19H38N10O6 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.30 |
| IUPAC Name | 2-[[2-[[2-(2-aminopropanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C19H38N10O6/c1-9(20)14(31)27-11(5-3-7-25-18(21)22)15(32)28-12(6-4-8-26-19(23)24)16(33)29-13(10(2)30)17(34)35/h9-13,30H,3-8,20H2,1-2H3,(H,27,31)(H,28,32)(H,29,33)(H,34,35)(H4,21,22,25)(H4,23,24,26) |
| InChIKey | FLKMRXYFSABEOQ-UHFFFAOYSA-N |
| XLogP | -4.64 |
| TPSA | 299.65 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | -4.64 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|