C16H31N7O6 — CID 18238949
2-[[2-[[2-(2-aminopropanoylamino)-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid (PubChem CID 18238949) has the molecular formula C16H31N7O6 and a molecular weight of 417.47 g/mol. Its IUPAC name is 2-[[2-[[2-(2-aminopropanoylamino)-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[2-(2-aminopropanoylamino)-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18238949 |
| Molecular Formula | C16H31N7O6 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 2-[[2-[[2-(2-aminopropanoylamino)-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid |
| SMILES | CC(N)C(=O)NC(C(=O)NC(CCCN=C(N)N)C(=O)NC(C)C(=O)O)C(C)O |
| InChI | InChI=1S/C16H31N7O6/c1-7(17)12(25)23-11(9(3)24)14(27)22-10(5-4-6-20-16(18)19)13(26)21-8(2)15(28)29/h7-11,24H,4-6,17H2,1-3H3,(H,21,26)(H,22,27)(H,23,25)(H,28,29)(H4,18,19,20) |
| InChIKey | BAZVVQHWIKDUTM-UHFFFAOYSA-N |
| XLogP | -3.67 |
| TPSA | 235.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | -3.67 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|