C18H34N8O7 — CID 22701288
2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-hydroxybutanoyl]amino]propanoic acid (PubChem CID 22701288) has the molecular formula C18H34N8O7 and a molecular weight of 474.52 g/mol. Its IUPAC name is 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-hydroxybutanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-hydroxybutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 22701288 |
| Molecular Formula | C18H34N8O7 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-hydroxybutanoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CCC(N)=O)C(C)O)C(=O)O |
| InChI | InChI=1S/C18H34N8O7/c1-8(17(32)33)24-16(31)13(9(2)27)26-15(30)11(4-3-7-23-18(21)22)25-14(29)10(19)5-6-12(20)28/h8-11,13,27H,3-7,19H2,1-2H3,(H2,20,28)(H,24,31)(H,25,29)(H,26,30)(H,32,33)(H4,21,22,23) |
| InChIKey | JMMOCZRGVWFYNT-UHFFFAOYSA-N |
| XLogP | -4.43 |
| TPSA | 278.34 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | -4.43 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|