C15H29N7O6 — CID 18218900
5-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-5-oxopentanoic acid (PubChem CID 18218900) has the molecular formula C15H29N7O6 and a molecular weight of 403.44 g/mol. Its IUPAC name is 5-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18218900 |
| Molecular Formula | C15H29N7O6 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | 5-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-5-oxopentanoic acid |
| SMILES | CC(O)C(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C15H29N7O6/c1-7(23)11(13(26)21-9(14(27)28)4-5-10(17)24)22-12(25)8(16)3-2-6-20-15(18)19/h7-9,11,23H,2-6,16H2,1H3,(H2,17,24)(H,21,26)(H,22,25)(H,27,28)(H4,18,19,20) |
| InChIKey | LYJXHXGPWDTLKW-UHFFFAOYSA-N |
| XLogP | -3.93 |
| TPSA | 249.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | -3.93 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|