C13H26N6O5S — CID 145453949
(2R)-2-[[(2S,3R)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 145453949) has the molecular formula C13H26N6O5S and a molecular weight of 378.46 g/mol. Its IUPAC name is (2R)-2-[[(2S,3R)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[(2S,3R)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 145453949 |
| Molecular Formula | C13H26N6O5S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (2R)-2-[[(2S,3R)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)[C@@H](N)CCCN=C(N)N)C(=O)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C13H26N6O5S/c1-6(20)9(11(22)18-8(5-25)12(23)24)19-10(21)7(14)3-2-4-17-13(15)16/h6-9,20,25H,2-5,14H2,1H3,(H,18,22)(H,19,21)(H,23,24)(H4,15,16,17)/t6-,7+,8+,9+/m1/s1 |
| InChIKey | HRCIIMCTUIAKQB-XGEHTFHBSA-N |
| XLogP | -3.27 |
| TPSA | 206.15 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|