C19H38N8O6S — CID 22650581
6-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid (PubChem CID 22650581) has the molecular formula C19H38N8O6S and a molecular weight of 506.63 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 22650581 |
| Molecular Formula | C19H38N8O6S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | 6-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid |
| SMILES | CC(O)C(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CS)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C19H38N8O6S/c1-10(28)14(27-15(29)11(21)5-4-8-24-19(22)23)17(31)26-13(9-34)16(30)25-12(18(32)33)6-2-3-7-20/h10-14,28,34H,2-9,20-21H2,1H3,(H,25,30)(H,26,31)(H,27,29)(H,32,33)(H4,22,23,24) |
| InChIKey | LCNPSSRHMWRIJB-UHFFFAOYSA-N |
| XLogP | -3.65 |
| TPSA | 261.27 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | -3.65 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|