C19H38N8O7 — CID 22650801
6-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxypropanoyl]amino]hexanoic acid (PubChem CID 22650801) has the molecular formula C19H38N8O7 and a molecular weight of 490.56 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxypropanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxypropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 22650801 |
| Molecular Formula | C19H38N8O7 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | 6-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxypropanoyl]amino]hexanoic acid |
| SMILES | CC(O)C(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CO)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C19H38N8O7/c1-10(29)14(27-15(30)11(21)5-4-8-24-19(22)23)17(32)26-13(9-28)16(31)25-12(18(33)34)6-2-3-7-20/h10-14,28-29H,2-9,20-21H2,1H3,(H,25,31)(H,26,32)(H,27,30)(H,33,34)(H4,22,23,24) |
| InChIKey | LGZSPWCKKYCSLI-UHFFFAOYSA-N |
| XLogP | -4.59 |
| TPSA | 281.50 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | -4.59 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|