C18H33N7O8S — CID 22650594
4-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-5-[(1-carboxy-2-sulfanylethyl)amino]-5-oxopentanoic acid (PubChem CID 22650594) has the molecular formula C18H33N7O8S and a molecular weight of 507.57 g/mol. Its IUPAC name is 4-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-5-[(1-carboxy-2-sulfanylethyl)amino]-5-oxopentanoic acid.
| Compound Name | 4-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-5-[(1-carboxy-2-sulfanylethyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 22650594 |
| Molecular Formula | C18H33N7O8S |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 4-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-5-[(1-carboxy-2-sulfanylethyl)amino]-5-oxopentanoic acid |
| SMILES | CC(O)C(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CCC(=O)O)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C18H33N7O8S/c1-8(26)13(25-14(29)9(19)3-2-6-22-18(20)21)16(31)23-10(4-5-12(27)28)15(30)24-11(7-34)17(32)33/h8-11,13,26,34H,2-7,19H2,1H3,(H,23,31)(H,24,30)(H,25,29)(H,27,28)(H,32,33)(H4,20,21,22) |
| InChIKey | STFXWCNHALIDCF-UHFFFAOYSA-N |
| XLogP | -3.92 |
| TPSA | 272.55 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | -3.92 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|