C16H31N7O7S — CID 22650414
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 22650414) has the molecular formula C16H31N7O7S and a molecular weight of 465.53 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 22650414 |
| Molecular Formula | C16H31N7O7S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC(O)C(NC(=O)C(CO)NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C16H31N7O7S/c1-7(25)11(14(28)22-10(6-31)15(29)30)23-13(27)9(5-24)21-12(26)8(17)3-2-4-20-16(18)19/h7-11,24-25,31H,2-6,17H2,1H3,(H,21,26)(H,22,28)(H,23,27)(H,29,30)(H4,18,19,20) |
| InChIKey | HDKHYTIFULPSID-UHFFFAOYSA-N |
| XLogP | -4.79 |
| TPSA | 255.48 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | -4.79 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|