C19H38N10O7 — CID 22650126
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 22650126) has the molecular formula C19H38N10O7 and a molecular weight of 518.58 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 22650126 |
| Molecular Formula | C19H38N10O7 |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(CO)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C19H38N10O7/c1-9(31)13(17(35)36)29-15(33)11(5-3-7-26-19(23)24)27-16(34)12(8-30)28-14(32)10(20)4-2-6-25-18(21)22/h9-13,30-31H,2-8,20H2,1H3,(H,27,34)(H,28,32)(H,29,33)(H,35,36)(H4,21,22,25)(H4,23,24,26) |
| InChIKey | CNWXGBKITGPSDB-UHFFFAOYSA-N |
| XLogP | -5.67 |
| TPSA | 319.88 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | -5.67 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|