C18H33N7O9 — CID 18242823
4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[1-[(1-carboxy-2-hydroxypropyl)amino]-3-hydroxy-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 18242823) has the molecular formula C18H33N7O9 and a molecular weight of 491.50 g/mol. Its IUPAC name is 4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[1-[(1-carboxy-2-hydroxypropyl)amino]-3-hydroxy-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[1-[(1-carboxy-2-hydroxypropyl)amino]-3-hydroxy-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18242823 |
| Molecular Formula | C18H33N7O9 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | 4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[1-[(1-carboxy-2-hydroxypropyl)amino]-3-hydroxy-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CC(O)C(NC(=O)C(CO)NC(=O)C(CCC(=O)O)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C18H33N7O9/c1-8(27)13(17(33)34)25-16(32)11(7-26)24-15(31)10(4-5-12(28)29)23-14(30)9(19)3-2-6-22-18(20)21/h8-11,13,26-27H,2-7,19H2,1H3,(H,23,30)(H,24,31)(H,25,32)(H,28,29)(H,33,34)(H4,20,21,22) |
| InChIKey | MMBDNPXQEFEZMV-UHFFFAOYSA-N |
| XLogP | -4.86 |
| TPSA | 292.78 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | -4.86 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|