C15H28N6O7 — CID 145455310
(4S)-4-amino-5-[[(2S)-1-[[(1S,2R)-1-carboxy-2-hydroxypropyl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 145455310) has the molecular formula C15H28N6O7 and a molecular weight of 404.42 g/mol. Its IUPAC name is (4S)-4-amino-5-[[(2S)-1-[[(1S,2R)-1-carboxy-2-hydroxypropyl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-amino-5-[[(2S)-1-[[(1S,2R)-1-carboxy-2-hydroxypropyl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 145455310 |
| Molecular Formula | C15H28N6O7 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | (4S)-4-amino-5-[[(2S)-1-[[(1S,2R)-1-carboxy-2-hydroxypropyl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H28N6O7/c1-7(22)11(14(27)28)21-13(26)9(3-2-6-19-15(17)18)20-12(25)8(16)4-5-10(23)24/h7-9,11,22H,2-6,16H2,1H3,(H,20,25)(H,21,26)(H,23,24)(H,27,28)(H4,17,18,19)/t7-,8+,9+,11+/m1/s1 |
| InChIKey | SRZLHYPAOXBBSB-HJGDQZAQSA-N |
| XLogP | -3.33 |
| TPSA | 243.45 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | -3.33 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|