C18H35N7O8 — CID 22650826
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 22650826) has the molecular formula C18H35N7O8 and a molecular weight of 477.52 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 22650826 |
| Molecular Formula | C18H35N7O8 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)CCCN=C(N)N)C(C)O)C(C)O)C(=O)O |
| InChI | InChI=1S/C18H35N7O8/c1-7(26)11(23-14(29)10(19)5-4-6-22-18(20)21)15(30)24-12(8(2)27)16(31)25-13(9(3)28)17(32)33/h7-13,26-28H,4-6,19H2,1-3H3,(H,23,29)(H,24,30)(H,25,31)(H,32,33)(H4,20,21,22) |
| InChIKey | LJQMHRNOUVFHIN-UHFFFAOYSA-N |
| XLogP | -4.95 |
| TPSA | 275.71 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | -4.95 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|