C16H32N6O4 — CID 145453997
(2S)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-methylbutanoic acid (PubChem CID 145453997) has the molecular formula C16H32N6O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 145453997 |
| Molecular Formula | C16H32N6O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](NC(=O)[C@@H](N)CCCN=C(N)N)C(C)C)C(=O)O |
| InChI | InChI=1S/C16H32N6O4/c1-8(2)11(14(24)22-12(9(3)4)15(25)26)21-13(23)10(17)6-5-7-20-16(18)19/h8-12H,5-7,17H2,1-4H3,(H,21,23)(H,22,24)(H,25,26)(H4,18,19,20)/t10-,11-,12-/m0/s1 |
| InChIKey | CGXQUULXFWRJOI-SRVKXCTJSA-N |
| XLogP | -1.27 |
| TPSA | 185.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|