C20H37N7O7 — CID 22651762
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-carboxypropanoyl]amino]-3-methylbutanoic acid (PubChem CID 22651762) has the molecular formula C20H37N7O7 and a molecular weight of 487.56 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-carboxypropanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-carboxypropanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 22651762 |
| Molecular Formula | C20H37N7O7 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-carboxypropanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)C(CC(=O)O)NC(=O)C(NC(=O)C(N)CCCN=C(N)N)C(C)C)C(=O)O |
| InChI | InChI=1S/C20H37N7O7/c1-9(2)14(26-16(30)11(21)6-5-7-24-20(22)23)18(32)25-12(8-13(28)29)17(31)27-15(10(3)4)19(33)34/h9-12,14-15H,5-8,21H2,1-4H3,(H,25,32)(H,26,30)(H,27,31)(H,28,29)(H,33,34)(H4,22,23,24) |
| InChIKey | ZNQPIXCSENEELL-UHFFFAOYSA-N |
| XLogP | -2.31 |
| TPSA | 252.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|