C22H42N10O7 — CID 18242888
4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 18242888) has the molecular formula C22H42N10O7 and a molecular weight of 558.64 g/mol. Its IUPAC name is 4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18242888 |
| Molecular Formula | C22H42N10O7 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | 4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)C(NC(=O)C(CCC(=O)O)NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C22H42N10O7/c1-11(2)16(19(37)31-14(20(38)39)6-4-10-29-22(26)27)32-18(36)13(7-8-15(33)34)30-17(35)12(23)5-3-9-28-21(24)25/h11-14,16H,3-10,23H2,1-2H3,(H,30,35)(H,31,37)(H,32,36)(H,33,34)(H,38,39)(H4,24,25,28)(H4,26,27,29) |
| InChIKey | IOZJYUXJXVSOHP-UHFFFAOYSA-N |
| XLogP | -3.52 |
| TPSA | 316.72 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | -3.52 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|