C16H30N6O6 — CID 25217364
(4S)-4-amino-5-[[(2S)-1-[[(1S)-1-carboxy-4-(diaminomethylideneamino)butyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 25217364) has the molecular formula C16H30N6O6 and a molecular weight of 402.45 g/mol. Its IUPAC name is (4S)-4-amino-5-[[(2S)-1-[[(1S)-1-carboxy-4-(diaminomethylideneamino)butyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-amino-5-[[(2S)-1-[[(1S)-1-carboxy-4-(diaminomethylideneamino)butyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 25217364 |
| Molecular Formula | C16H30N6O6 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | (4S)-4-amino-5-[[(2S)-1-[[(1S)-1-carboxy-4-(diaminomethylideneamino)butyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](N)CCC(=O)O)C(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C16H30N6O6/c1-8(2)12(22-13(25)9(17)5-6-11(23)24)14(26)21-10(15(27)28)4-3-7-20-16(18)19/h8-10,12H,3-7,17H2,1-2H3,(H,21,26)(H,22,25)(H,23,24)(H,27,28)(H4,18,19,20)/t9-,10-,12-/m0/s1 |
| InChIKey | MLILEEIVMRUYBX-NHCYSSNCSA-N |
| XLogP | -2.06 |
| TPSA | 223.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|