C22H41N7O7 — CID 22703228
2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]pentanedioic acid (PubChem CID 22703228) has the molecular formula C22H41N7O7 and a molecular weight of 515.61 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 22703228 |
| Molecular Formula | C22H41N7O7 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.31 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]pentanedioic acid |
| SMILES | CC(C)CC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(C(=O)NC(CCC(=O)O)C(=O)O)C(C)C |
| InChI | InChI=1S/C22H41N7O7/c1-11(2)10-13(23)18(32)27-14(6-5-9-26-22(24)25)19(33)29-17(12(3)4)20(34)28-15(21(35)36)7-8-16(30)31/h11-15,17H,5-10,23H2,1-4H3,(H,27,32)(H,28,34)(H,29,33)(H,30,31)(H,35,36)(H4,24,25,26) |
| InChIKey | AWQPQSNCZMTHAZ-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 252.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|