C20H37N7O8 — CID 18300360
2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid (PubChem CID 18300360) has the molecular formula C20H37N7O8 and a molecular weight of 503.56 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18300360 |
| Molecular Formula | C20H37N7O8 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid |
| SMILES | CC(C)CC(N)C(=O)NC(CO)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H37N7O8/c1-10(2)8-11(21)16(31)27-14(9-28)18(33)25-12(4-3-7-24-20(22)23)17(32)26-13(19(34)35)5-6-15(29)30/h10-14,28H,3-9,21H2,1-2H3,(H,25,33)(H,26,32)(H,27,31)(H,29,30)(H,34,35)(H4,22,23,24) |
| InChIKey | SVMONURIYYHOED-UHFFFAOYSA-N |
| XLogP | -3.19 |
| TPSA | 272.55 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | -3.19 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|