C29H54N8O8 — CID 23128530
2-[[2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-4-methylpentanoyl]amino]-4-carboxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoic acid (PubChem CID 23128530) has the molecular formula C29H54N8O8 and a molecular weight of 642.80 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-4-methylpentanoyl]amino]-4-carboxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-4-methylpentanoyl]amino]-4-carboxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 23128530 |
| Molecular Formula | C29H54N8O8 |
| Molecular Weight | 642.80 g/mol |
| Exact Mass | 642.41 |
| IUPAC Name | 2-[[2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-4-methylpentanoyl]amino]-4-carboxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(N)C(=O)NC(CC(C)C)C(=O)NC(CCC(=O)O)C(=O)NC(CCCN=C(N)N)C(=O)NC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C29H54N8O8/c1-15(2)12-18(30)24(40)36-21(13-16(3)4)27(43)35-20(9-10-23(38)39)26(42)34-19(8-7-11-33-29(31)32)25(41)37-22(28(44)45)14-17(5)6/h15-22H,7-14,30H2,1-6H3,(H,34,42)(H,35,43)(H,36,40)(H,37,41)(H,38,39)(H,44,45)(H4,31,32,33) |
| InChIKey | QCDMJDGNQNYSIR-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 281.42 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.80 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|