C22H39N7O9 — CID 18264642
4-amino-5-[[4-carboxy-1-[[1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxobutan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 18264642) has the molecular formula C22H39N7O9 and a molecular weight of 545.59 g/mol. Its IUPAC name is 4-amino-5-[[4-carboxy-1-[[1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxobutan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-amino-5-[[4-carboxy-1-[[1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxobutan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18264642 |
| Molecular Formula | C22H39N7O9 |
| Molecular Weight | 545.59 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | 4-amino-5-[[4-carboxy-1-[[1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxobutan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(CCC(=O)O)NC(=O)C(N)CCC(=O)O)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C22H39N7O9/c1-11(2)10-15(20(36)28-14(21(37)38)4-3-9-26-22(24)25)29-19(35)13(6-8-17(32)33)27-18(34)12(23)5-7-16(30)31/h11-15H,3-10,23H2,1-2H3,(H,27,34)(H,28,36)(H,29,35)(H,30,31)(H,32,33)(H,37,38)(H4,24,25,26) |
| InChIKey | DZXJPOLOZGJQCW-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 289.62 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.59 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|