C23H43N7O7 — CID 22703049
2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]pentanedioic acid (PubChem CID 22703049) has the molecular formula C23H43N7O7 and a molecular weight of 529.64 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 22703049 |
| Molecular Formula | C23H43N7O7 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.32 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]pentanedioic acid |
| SMILES | CC(C)CC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CC(C)C)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H43N7O7/c1-12(2)10-14(24)19(33)28-15(6-5-9-27-23(25)26)20(34)30-17(11-13(3)4)21(35)29-16(22(36)37)7-8-18(31)32/h12-17H,5-11,24H2,1-4H3,(H,28,33)(H,29,35)(H,30,34)(H,31,32)(H,36,37)(H4,25,26,27) |
| InChIKey | MPSRULCIRLZFRL-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 252.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|