C22H41N9O7 — CID 175735152
(2S)-5-amino-2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]-4-methylpentanoyl]amino]pentanoyl]amino]-5-oxopentanoic acid (PubChem CID 175735152) has the molecular formula C22H41N9O7 and a molecular weight of 543.63 g/mol. Its IUPAC name is (2S)-5-amino-2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]-4-methylpentanoyl]amino]pentanoyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]-4-methylpentanoyl]amino]pentanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 175735152 |
| Molecular Formula | C22H41N9O7 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.31 |
| IUPAC Name | (2S)-5-amino-2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]-4-methylpentanoyl]amino]pentanoyl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)CCC(N)=O)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C22H41N9O7/c1-11(2)10-15(31-18(34)12(23)5-7-16(24)32)20(36)29-13(4-3-9-28-22(26)27)19(35)30-14(21(37)38)6-8-17(25)33/h11-15H,3-10,23H2,1-2H3,(H2,24,32)(H2,25,33)(H,29,36)(H,30,35)(H,31,34)(H,37,38)(H4,26,27,28)/t12-,13-,14-,15-/m0/s1 |
| InChIKey | DTEATOSDHXNTLW-AJNGGQMLSA-N |
| XLogP | -3.52 |
| TPSA | 301.20 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | -3.52 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|