C17H33N7O5 — CID 145454969
(2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]pentanoyl]amino]-4-methylpentanoic acid (PubChem CID 145454969) has the molecular formula C17H33N7O5 and a molecular weight of 415.50 g/mol. Its IUPAC name is (2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]pentanoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]pentanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 145454969 |
| Molecular Formula | C17H33N7O5 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | (2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]pentanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C17H33N7O5/c1-9(2)8-12(16(28)29)24-15(27)11(4-3-7-22-17(20)21)23-14(26)10(18)5-6-13(19)25/h9-12H,3-8,18H2,1-2H3,(H2,19,25)(H,23,26)(H,24,27)(H,28,29)(H4,20,21,22)/t10-,11-,12-/m0/s1 |
| InChIKey | PRBLYKYHAJEABA-SRVKXCTJSA-N |
| XLogP | -2.27 |
| TPSA | 229.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|