C23H45N9O6 — CID 18245017
2-[[5-amino-2-[[6-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-5-oxopentanoyl]amino]-4-methylpentanoic acid (PubChem CID 18245017) has the molecular formula C23H45N9O6 and a molecular weight of 543.67 g/mol. Its IUPAC name is 2-[[5-amino-2-[[6-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-5-oxopentanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[5-amino-2-[[6-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-5-oxopentanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 18245017 |
| Molecular Formula | C23H45N9O6 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.35 |
| IUPAC Name | 2-[[5-amino-2-[[6-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-5-oxopentanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(CCC(N)=O)NC(=O)C(CCCCN)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C23H45N9O6/c1-13(2)12-17(22(37)38)32-21(36)16(8-9-18(26)33)31-20(35)15(7-3-4-10-24)30-19(34)14(25)6-5-11-29-23(27)28/h13-17H,3-12,24-25H2,1-2H3,(H2,26,33)(H,30,34)(H,31,35)(H,32,36)(H,37,38)(H4,27,28,29) |
| InChIKey | SDZJNXZMZFFMSD-UHFFFAOYSA-N |
| XLogP | -2.65 |
| TPSA | 284.13 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|