C21H39N9O8 — CID 18243128
2-[[6-amino-2-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]hexanoyl]amino]butanedioic acid (PubChem CID 18243128) has the molecular formula C21H39N9O8 and a molecular weight of 545.60 g/mol. Its IUPAC name is 2-[[6-amino-2-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]hexanoyl]amino]butanedioic acid.
| Compound Name | 2-[[6-amino-2-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]hexanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18243128 |
| Molecular Formula | C21H39N9O8 |
| Molecular Weight | 545.60 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | 2-[[6-amino-2-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]hexanoyl]amino]butanedioic acid |
| SMILES | NCCCCC(NC(=O)C(CCC(N)=O)NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C21H39N9O8/c22-8-2-1-5-12(18(35)30-14(20(37)38)10-16(32)33)29-19(36)13(6-7-15(24)31)28-17(34)11(23)4-3-9-27-21(25)26/h11-14H,1-10,22-23H2,(H2,24,31)(H,28,34)(H,29,36)(H,30,35)(H,32,33)(H,37,38)(H4,25,26,27) |
| InChIKey | VMWPRILAQIXUGI-UHFFFAOYSA-N |
| XLogP | -4.22 |
| TPSA | 321.43 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.60 |
| LogP ≤ 5 | -4.22 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|