C21H38N8O8 — CID 22703669
5-amino-2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-carboxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid (PubChem CID 22703669) has the molecular formula C21H38N8O8 and a molecular weight of 530.58 g/mol. Its IUPAC name is 5-amino-2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-carboxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-carboxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 22703669 |
| Molecular Formula | C21H38N8O8 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | 5-amino-2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-carboxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)CC(N)C(=O)NC(CC(=O)O)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C21H38N8O8/c1-10(2)8-11(22)17(33)29-14(9-16(31)32)19(35)27-12(4-3-7-26-21(24)25)18(34)28-13(20(36)37)5-6-15(23)30/h10-14H,3-9,22H2,1-2H3,(H2,23,30)(H,27,35)(H,28,34)(H,29,33)(H,31,32)(H,36,37)(H4,24,25,26) |
| InChIKey | GPZCSVBHTVIATQ-UHFFFAOYSA-N |
| XLogP | -3.31 |
| TPSA | 295.41 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|