C22H43N7O5 — CID 22703242
2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-methylbutanoic acid (PubChem CID 22703242) has the molecular formula C22H43N7O5 and a molecular weight of 485.63 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 22703242 |
| Molecular Formula | C22H43N7O5 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.33 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)CC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(C(=O)NC(C(=O)O)C(C)C)C(C)C |
| InChI | InChI=1S/C22H43N7O5/c1-11(2)10-14(23)18(30)27-15(8-7-9-26-22(24)25)19(31)28-16(12(3)4)20(32)29-17(13(5)6)21(33)34/h11-17H,7-10,23H2,1-6H3,(H,27,30)(H,28,31)(H,29,32)(H,33,34)(H4,24,25,26) |
| InChIKey | CWMQHLOVCGPXIF-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|