C14H28N6O4S — CID 18219782
2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid (PubChem CID 18219782) has the molecular formula C14H28N6O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is 2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 18219782 |
| Molecular Formula | C14H28N6O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C14H28N6O4S/c1-7(2)10(13(23)24)20-12(22)9(4-3-5-18-14(16)17)19-11(21)8(15)6-25/h7-10,25H,3-6,15H2,1-2H3,(H,19,21)(H,20,22)(H,23,24)(H4,16,17,18) |
| InChIKey | XGIAHEUULGOZHH-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 185.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|