C15H30N6O4S — CID 145454644
(2S,3S)-2-[[(2S)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoic acid (PubChem CID 145454644) has the molecular formula C15H30N6O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is (2S,3S)-2-[[(2S)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-[[(2S)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 145454644 |
| Molecular Formula | C15H30N6O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | (2S,3S)-2-[[(2S)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CS)C(=O)O |
| InChI | InChI=1S/C15H30N6O4S/c1-3-8(2)11(14(24)25)21-13(23)10(5-4-6-19-15(17)18)20-12(22)9(16)7-26/h8-11,26H,3-7,16H2,1-2H3,(H,20,22)(H,21,23)(H,24,25)(H4,17,18,19)/t8-,9-,10-,11-/m0/s1 |
| InChIKey | LHLSSZYQFUNWRZ-NAKRPEOUSA-N |
| XLogP | -1.60 |
| TPSA | 185.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|