C24H49N11O5 — CID 18241144
2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-3-methylpentanoic acid (PubChem CID 18241144) has the molecular formula C24H49N11O5 and a molecular weight of 571.73 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18241144 |
| Molecular Formula | C24H49N11O5 |
| Molecular Weight | 571.73 g/mol |
| Exact Mass | 571.39 |
| IUPAC Name | 2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CCCCN)NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C24H49N11O5/c1-3-14(2)18(22(39)40)35-21(38)16(9-4-5-11-25)34-20(37)17(10-7-13-32-24(29)30)33-19(36)15(26)8-6-12-31-23(27)28/h14-18H,3-13,25-26H2,1-2H3,(H,33,36)(H,34,37)(H,35,38)(H,39,40)(H4,27,28,31)(H4,29,30,32) |
| InChIKey | IFASTQDIIKRQPY-UHFFFAOYSA-N |
| XLogP | -2.87 |
| TPSA | 305.44 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.73 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|