C22H42N8O7 — CID 18305894
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid (PubChem CID 18305894) has the molecular formula C22H42N8O7 and a molecular weight of 530.63 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18305894 |
| Molecular Formula | C22H42N8O7 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.32 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid |
| SMILES | CCC(C)C(NC(=O)C(N)CCCCN)C(=O)NC(CCCN=C(N)N)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H42N8O7/c1-3-12(2)17(30-18(33)13(24)7-4-5-9-23)20(35)28-14(8-6-10-27-22(25)26)19(34)29-15(21(36)37)11-16(31)32/h12-15,17H,3-11,23-24H2,1-2H3,(H,28,35)(H,29,34)(H,30,33)(H,31,32)(H,36,37)(H4,25,26,27) |
| InChIKey | GPIMOBAKCAFHDZ-UHFFFAOYSA-N |
| XLogP | -2.44 |
| TPSA | 278.34 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|