C22H43N9O6 — CID 18302894
4-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]-4-oxobutanoic acid (PubChem CID 18302894) has the molecular formula C22H43N9O6 and a molecular weight of 529.64 g/mol. Its IUPAC name is 4-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18302894 |
| Molecular Formula | C22H43N9O6 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.33 |
| IUPAC Name | 4-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]-4-oxobutanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CCCCN)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C22H43N9O6/c1-3-12(2)17(20(35)30-15(21(36)37)11-16(25)32)31-19(34)14(8-6-10-28-22(26)27)29-18(33)13(24)7-4-5-9-23/h12-15,17H,3-11,23-24H2,1-2H3,(H2,25,32)(H,29,33)(H,30,35)(H,31,34)(H,36,37)(H4,26,27,28) |
| InChIKey | DBAMYBUYLFGLIM-UHFFFAOYSA-N |
| XLogP | -3.04 |
| TPSA | 284.13 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|