C18H37N7O4 — CID 145453855
(2S)-6-amino-2-[[(2S,3S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]hexanoic acid (PubChem CID 145453855) has the molecular formula C18H37N7O4 and a molecular weight of 415.54 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S,3S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S,3S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 145453855 |
| Molecular Formula | C18H37N7O4 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | (2S)-6-amino-2-[[(2S,3S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]hexanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@@H](N)CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C18H37N7O4/c1-3-11(2)14(16(27)24-13(17(28)29)8-4-5-9-19)25-15(26)12(20)7-6-10-23-18(21)22/h11-14H,3-10,19-20H2,1-2H3,(H,24,27)(H,25,26)(H,28,29)(H4,21,22,23)/t11-,12-,13-,14-/m0/s1 |
| InChIKey | LKDHUGLXOHYINY-XUXIUFHCSA-N |
| XLogP | -1.40 |
| TPSA | 211.94 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|