C21H41N7O5S — CID 18258655
2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-4-methylpentanoyl]amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18258655) has the molecular formula C21H41N7O5S and a molecular weight of 503.67 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-4-methylpentanoyl]amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-4-methylpentanoyl]amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18258655 |
| Molecular Formula | C21H41N7O5S |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.29 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-4-methylpentanoyl]amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CC(C)C)NC(=O)C(N)CS)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C21H41N7O5S/c1-5-12(4)16(19(31)26-14(20(32)33)7-6-8-25-21(23)24)28-18(30)15(9-11(2)3)27-17(29)13(22)10-34/h11-16,34H,5-10,22H2,1-4H3,(H,26,31)(H,27,29)(H,28,30)(H,32,33)(H4,23,24,25) |
| InChIKey | JWPFYFWAQKVWHJ-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|