C23H44N10O7 — CID 18242536
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-carboxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoic acid (PubChem CID 18242536) has the molecular formula C23H44N10O7 and a molecular weight of 572.67 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-carboxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-carboxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18242536 |
| Molecular Formula | C23H44N10O7 |
| Molecular Weight | 572.67 g/mol |
| Exact Mass | 572.34 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-carboxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(CCC(=O)O)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C23H44N10O7/c1-3-12(2)17(21(39)40)33-20(38)14(7-5-11-30-23(27)28)32-19(37)15(8-9-16(34)35)31-18(36)13(24)6-4-10-29-22(25)26/h12-15,17H,3-11,24H2,1-2H3,(H,31,36)(H,32,37)(H,33,38)(H,34,35)(H,39,40)(H4,25,26,29)(H4,27,28,30) |
| InChIKey | GSJBKFGNKJTTNO-UHFFFAOYSA-N |
| XLogP | -3.13 |
| TPSA | 316.72 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.67 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|