C20H38N8O6 — CID 18242915
2-[2-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]propanoylamino]-3-methylpentanoic acid (PubChem CID 18242915) has the molecular formula C20H38N8O6 and a molecular weight of 486.57 g/mol. Its IUPAC name is 2-[2-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]propanoylamino]-3-methylpentanoic acid.
| Compound Name | 2-[2-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]propanoylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18242915 |
| Molecular Formula | C20H38N8O6 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | 2-[2-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]propanoylamino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(C)NC(=O)C(CCC(N)=O)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C20H38N8O6/c1-4-10(2)15(19(33)34)28-16(30)11(3)26-18(32)13(7-8-14(22)29)27-17(31)12(21)6-5-9-25-20(23)24/h10-13,15H,4-9,21H2,1-3H3,(H2,22,29)(H,26,32)(H,27,31)(H,28,30)(H,33,34)(H4,23,24,25) |
| InChIKey | FOFYMCHIHVVWNU-UHFFFAOYSA-N |
| XLogP | -2.76 |
| TPSA | 258.11 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|