C17H33N7O7S — CID 18255220
2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 18255220) has the molecular formula C17H33N7O7S and a molecular weight of 479.56 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 18255220 |
| Molecular Formula | C17H33N7O7S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NC(=O)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CS)C(C)O)C(=O)O |
| InChI | InChI=1S/C17H33N7O7S/c1-7(25)11(15(29)24-12(8(2)26)16(30)31)23-14(28)10(4-3-5-21-17(19)20)22-13(27)9(18)6-32/h7-12,25-26,32H,3-6,18H2,1-2H3,(H,22,27)(H,23,28)(H,24,29)(H,30,31)(H4,19,20,21) |
| InChIKey | SVARMSVPWHFZEE-UHFFFAOYSA-N |
| XLogP | -4.40 |
| TPSA | 255.48 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | -4.40 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|