C15H29N7O6S — CID 18257317
2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 18257317) has the molecular formula C15H29N7O6S and a molecular weight of 435.51 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 18257317 |
| Molecular Formula | C15H29N7O6S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NC(=O)C(CCCN=C(N)N)NC(=O)CNC(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C15H29N7O6S/c1-7(23)11(14(27)28)22-13(26)9(3-2-4-19-15(17)18)21-10(24)5-20-12(25)8(16)6-29/h7-9,11,23,29H,2-6,16H2,1H3,(H,20,25)(H,21,24)(H,22,26)(H,27,28)(H4,17,18,19) |
| InChIKey | MELFMRRZGUVSSX-UHFFFAOYSA-N |
| XLogP | -4.15 |
| TPSA | 235.25 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | -4.15 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|