C23H46N10O6S — CID 11180839
(2S)-6-amino-2-[[(2S)-2-[[(2S)-6-amino-2-[[2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]acetyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid (PubChem CID 11180839) has the molecular formula C23H46N10O6S and a molecular weight of 590.75 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[[(2S)-6-amino-2-[[2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]acetyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-6-amino-2-[[2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]acetyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 11180839 |
| Molecular Formula | C23H46N10O6S |
| Molecular Weight | 590.75 g/mol |
| Exact Mass | 590.33 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-6-amino-2-[[2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]acetyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CCCCN)NC(=O)CNC(=O)[C@@H](N)CS)C(=O)O |
| InChI | InChI=1S/C23H46N10O6S/c24-9-3-1-6-15(31-18(34)12-30-19(35)14(26)13-40)20(36)32-16(8-5-11-29-23(27)28)21(37)33-17(22(38)39)7-2-4-10-25/h14-17,40H,1-13,24-26H2,(H,30,35)(H,31,34)(H,32,36)(H,33,37)(H,38,39)(H4,27,28,29)/t14-,15-,16-,17-/m0/s1 |
| InChIKey | KJVVMRURBCSZHH-QAETUUGQSA-N |
| XLogP | -3.79 |
| TPSA | 296.16 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.75 |
| LogP ≤ 5 | -3.79 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|