C18H34N8O7 — CID 18305146
2-[[3-carboxy-2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18305146) has the molecular formula C18H34N8O7 and a molecular weight of 474.52 g/mol. Its IUPAC name is 2-[[3-carboxy-2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[3-carboxy-2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18305146 |
| Molecular Formula | C18H34N8O7 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 2-[[3-carboxy-2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NCCCCC(N)C(=O)NCC(=O)NC(CC(=O)O)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C18H34N8O7/c19-6-2-1-4-10(20)15(30)24-9-13(27)25-12(8-14(28)29)16(31)26-11(17(32)33)5-3-7-23-18(21)22/h10-12H,1-9,19-20H2,(H,24,30)(H,25,27)(H,26,31)(H,28,29)(H,32,33)(H4,21,22,23) |
| InChIKey | BWNAIEYIQIOOCT-UHFFFAOYSA-N |
| XLogP | -3.86 |
| TPSA | 278.34 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | -3.86 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|