C17H34N8O5S — CID 18243518
2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]hexanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18243518) has the molecular formula C17H34N8O5S and a molecular weight of 462.58 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]hexanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]hexanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18243518 |
| Molecular Formula | C17H34N8O5S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]hexanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | NCCCCC(NC(=O)CNC(=O)C(N)CCCN=C(N)N)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C17H34N8O5S/c18-6-2-1-5-11(15(28)25-12(9-31)16(29)30)24-13(26)8-23-14(27)10(19)4-3-7-22-17(20)21/h10-12,31H,1-9,18-19H2,(H,23,27)(H,24,26)(H,25,28)(H,29,30)(H4,20,21,22) |
| InChIKey | VIEGBCKFMCDQDD-UHFFFAOYSA-N |
| XLogP | -3.40 |
| TPSA | 241.04 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|