C17H34N10O5S — CID 18257302
2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18257302) has the molecular formula C17H34N10O5S and a molecular weight of 490.59 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18257302 |
| Molecular Formula | C17H34N10O5S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(CCCN=C(N)N)NC(=O)CNC(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C17H34N10O5S/c18-9(8-33)13(29)25-7-12(28)26-10(3-1-5-23-16(19)20)14(30)27-11(15(31)32)4-2-6-24-17(21)22/h9-11,33H,1-8,18H2,(H,25,29)(H,26,28)(H,27,30)(H,31,32)(H4,19,20,23)(H4,21,22,24) |
| InChIKey | ZOTUHZCUMZHVRK-UHFFFAOYSA-N |
| XLogP | -4.48 |
| TPSA | 279.42 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | -4.48 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|