C20H41N9O5 — CID 18305296
2-[[6-amino-2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18305296) has the molecular formula C20H41N9O5 and a molecular weight of 487.61 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18305296 |
| Molecular Formula | C20H41N9O5 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.32 |
| IUPAC Name | 2-[[6-amino-2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NCCCCC(N)C(=O)NCC(=O)NC(CCCCN)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C20H41N9O5/c21-9-3-1-6-13(23)17(31)27-12-16(30)28-14(7-2-4-10-22)18(32)29-15(19(33)34)8-5-11-26-20(24)25/h13-15H,1-12,21-23H2,(H,27,31)(H,28,30)(H,29,32)(H,33,34)(H4,24,25,26) |
| InChIKey | QQCFEOPDKSXATE-UHFFFAOYSA-N |
| XLogP | -3.20 |
| TPSA | 267.06 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|