C19H37N9O6 — CID 18243056
6-amino-2-[[2-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]acetyl]amino]hexanoic acid (PubChem CID 18243056) has the molecular formula C19H37N9O6 and a molecular weight of 487.56 g/mol. Its IUPAC name is 6-amino-2-[[2-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]acetyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18243056 |
| Molecular Formula | C19H37N9O6 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | 6-amino-2-[[2-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]acetyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)CNC(=O)C(CCC(N)=O)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C19H37N9O6/c20-8-2-1-5-13(18(33)34)27-15(30)10-26-17(32)12(6-7-14(22)29)28-16(31)11(21)4-3-9-25-19(23)24/h11-13H,1-10,20-21H2,(H2,22,29)(H,26,32)(H,27,30)(H,28,31)(H,33,34)(H4,23,24,25) |
| InChIKey | ALNQYSXUOFEETL-UHFFFAOYSA-N |
| XLogP | -4.07 |
| TPSA | 284.13 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | -4.07 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|